Wikidata entity: Q27070792
C₂₀H₃₀O₃ (P274)
Quantities
| P2067 | mass | 318.219495 |
| P233 | canonical SMILES | String | CCC(C=CC=CCC=CCC=CCC=CCCCC(=O)O)O | ??? |
| P703 | found in taxon | ... | Q91703 (Caenorhabditis elegans) | Caenorhabditis elegans |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC[C@H](/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O)O | ??? |
| P3364 | stereoisomer of | ... | Q113947728 ((5Z,8Z,11E,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoic acid) | (5Z,8Z,11E,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoic acid |
| P3364 | stereoisomer of | ... | Q27070794 (18S-HEPE) | 18S-HEPE |
| P279 | subclass of | ... | Q27140156 (18-HEPE) | 18-HEPE |
| P2868 | subject has role | ... | Q3333419 (primary metabolite) | primary metabolite |
| P683 | ChEBI ID | 81563 |
| P661 | ChemSpider ID | 17220809 |
| P595 | Guide to Pharmacology Ligand ID | 3400 |
| P2057 | Human Metabolome Database ID | HMDB0012611 |
| P2057 | Human Metabolome Database ID | HMDB0062222 |
| P234 | InChI | InChI=1S/C20H30O3/c1-2-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)23/h4-7,10-13,15,17,19,21H,2-3,8-9,14,16,18H2,1H3,(H,22,23)/b6-4-,7-5-,12-10-,13-11-,17-15+/t19-/m1/s1 |
| P235 | InChIKey | LRWYBGFSVUBWMO-UAAZXLHOSA-N |
| P665 | KEGG ID | C18177 |
| P2063 | LIPID MAPS ID | LMFA03070025 |
| P11199 | Probes And Drugs ID | PD046776 |
| P662 | PubChem CID | 16061126 |
| P1579 | Reaxys registry number | 21591942 |
| P4964 | SPLASH | splash10-0079-0898000000-6ca7fd56c11838368d6b |
| P2877 | SureChEMBL ID | 3410454 |
| P11089 | UniChem compound ID | 1070740 |
Why not click here or view trends?
log id: 6651121