Wikidata entity: Q27074546
C₃₀H₄₂N₈O₃ (P274)
Quantities
| P2067 | mass | 562.337987 |
| P233 | canonical SMILES | String | CCC1=NC(=C(N=C1OC2CCN(C2)C(=O)C=C)NC3=CC=C(C=C3)N4CCC(CC4)N5CCN(CC5)C)C(=O)N | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCC1=NC(=C(N=C1O[C@@H]2CCN(C2)C(=O)C=C)NC3=CC=C(C=C3)N4CCC(CC4)N5CCN(CC5)C)C(=O)N | ??? |
| P129 | physically interacts with | ... | Q424401 (epidermal growth factor receptor) | epidermal growth factor receptor |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1448232-80-1 |
| P592 | ChEMBL ID | CHEMBL3663929 |
| P661 | ChemSpider ID | 44210447 |
| P715 | DrugBank ID | DB12036 |
| P595 | Guide to Pharmacology Ligand ID | 9248 |
| P234 | InChI | InChI=1S/C30H42N8O3/c1-4-25-30(41-24-12-15-38(20-24)26(39)5-2)34-29(27(33-25)28(31)40)32-21-6-8-22(9-7-21)36-13-10-23(11-14-36)37-18-16-35(3)17-19-37/h5-9,23-24H,2,4,10-20H2,1,3H3,(H2,31,40)(H,32,34)/t24-/m1/s1 |
| P235 | InChIKey | QKDCLUARMDUUKN-XMMPIXPASA-N |
| P3636 | PDB ligand ID | 8RC |
| P11199 | Probes And Drugs ID | PD050552 |
| P662 | PubChem CID | 71667668 |
| P2877 | SureChEMBL ID | 16196078 |
| P2877 | SureChEMBL ID | 29355759 |
| P11089 | UniChem compound ID | 45231623 |
| P652 | UNII | 47DD4548PB |
Why not click here or view trends?
log id: 4743620