Wikidata entity: Q27074708
C₁₉H₁₃ClF₃N₃O₃ (P274)
Quantities
| P2067 | mass | 423.059754 |
| P233 | canonical SMILES | String | CC1=C2C(=CC(=C1)Cl)C3(C(=O)NC(=O)N3)C(=O)N2CC4=CC(=CC=C4)C(F)(F)F | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q413209 (Transient receptor potential cation channel subfamily V member 1) | Transient receptor potential cation channel subfamily V member 1 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P592 | ChEMBL ID | CHEMBL3545039 |
| P661 | ChemSpider ID | 30915054 |
| P595 | Guide to Pharmacology Ligand ID | 7820 |
| P234 | InChI | InChI=1S/C19H13ClF3N3O3/c1-9-5-12(20)7-13-14(9)26(16(28)18(13)15(27)24-17(29)25-18)8-10-3-2-4-11(6-10)19(21,22)23/h2-7H,8H2,1H3,(H2,24,25,27,29) |
| P235 | InChIKey | DXDVSYALLVVBOV-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD049458 |
| P662 | PubChem CID | 24752296 |
| P2877 | SureChEMBL ID | 4257077 |
| P11089 | UniChem compound ID | 30161598 |
Why not click here or view trends?
log id: 8753299