Wikidata entity: Q27074865
C₂₆H₃₁FN₇O₆P (P274)
Quantities
| P2067 | mass | 587.205747 |
| P233 | canonical SMILES | String | CCN(CCCOC1=CC2=C(C=C1)C(=NC=N2)NC3=NNC(=C3)CC(=O)NC4=CC(=CC=C4)F)CCOP(=O)(O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q4822491 (Aurora kinase B) | Aurora kinase B |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 722543-31-9 |
| P683 | ChEBI ID | 167636 |
| P592 | ChEMBL ID | CHEMBL415049 |
| P661 | ChemSpider ID | 9672789 |
| P715 | DrugBank ID | DB11747 |
| P8494 | DSSTOX compound identifier | DTXCID30145074 |
| P3117 | DSSTox substance ID | DTXSID00222583 |
| P595 | Guide to Pharmacology Ligand ID | 7332 |
| P2057 | Human Metabolome Database ID | HMDB0248867 |
| P234 | InChI | InChI=1S/C26H31FN7O6P/c1-2-34(10-12-40-41(36,37)38)9-4-11-39-21-7-8-22-23(16-21)28-17-29-26(22)31-24-14-20(32-33-24)15-25(35)30-19-6-3-5-18(27)13-19/h3,5-8,13-14,16-17H,2,4,9-12,15H2,1H3,(H,30,35)(H2,36,37,38)(H2,28,29,31,32,33) |
| P235 | InChIKey | GBJVVSCPOBPEIT-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD036155 |
| P662 | PubChem CID | 11497983 |
| P2877 | SureChEMBL ID | 613582 |
| P11089 | UniChem compound ID | 563138 |
| P652 | UNII | 16XC2U7W8N |
Why not click here or view trends?
log id: 2040726