Wikidata entity: Q27076926
C₂₃H₂₄N₈O₄S (P274)
Quantities
| P2067 | mass | 508.164122 |
| P233 | canonical SMILES | String | CN(CC1=CC2=C(S1)C(=NC(=N2)C3=CN=C(C=C3)OC)N4CCOCC4)C5=NC=C(C=N5)C(=O)NO | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q5629167 (histone deacetylase 1) | histone deacetylase 1 |
| P129 | physically interacts with | ... | Q21140676 (Histone deacetylase 11) | Histone deacetylase 11 |
| P129 | physically interacts with | ... | Q21154358 (Histone deacetylase 3) | Histone deacetylase 3 |
| P129 | physically interacts with | ... | Q21173381 (Histone deacetylase 6) | Histone deacetylase 6 |
| P129 | physically interacts with | ... | Q21173406 (Histone deacetylase 8) | Histone deacetylase 8 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1339928-25-4 |
| P592 | ChEMBL ID | CHEMBL3622533 |
| P661 | ChemSpider ID | 29314960 |
| P715 | DrugBank ID | DB11891 |
| P8494 | DSSTOX compound identifier | DTXCID00663053 |
| P3117 | DSSTox substance ID | DTXSID90712307 |
| P595 | Guide to Pharmacology Ligand ID | 8952 |
| P234 | InChI | InChI=1S/C23H24N8O4S/c1-30(23-25-11-15(12-26-23)22(32)29-33)13-16-9-17-19(36-16)21(31-5-7-35-8-6-31)28-20(27-17)14-3-4-18(34-2)24-10-14/h3-4,9-12,33H,5-8,13H2,1-2H3,(H,29,32) |
| P235 | InChIKey | JOWXJLIFIIOYMS-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD010586 |
| P662 | PubChem CID | 54575456 |
| P2877 | SureChEMBL ID | 1284705 |
| P11089 | UniChem compound ID | 32051855 |
| P652 | UNII | 3S9RX35S5X |
Why not click here or view trends?
log id: 9693578