Wikidata entity: Q27088142
C₄₉H₆₆N₁₀O₁₀S₂ (P274)
Quantities
| P2067 | mass | 1018.44048 |
| P233 | canonical SMILES | String | CC(C1C(=O)NC(CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)CC4=CC=CC=C4)NC(=O)C(CC5=CC=CC=C5)N)C(=O)NC(CO)C(C)O)O | ??? |
| P1889 | different from | ... | Q419935 (octreotide) | octreotide |
| P1889 | different from | ... | Q63413189 ((4R,7S,10S,13R,16S,19R)-10-(4-aminobutyl)-16-benzyl-N-[(2R,3R)-1,3-dihydroxy-2-butanyl]-7-(1-hydroxyethyl)-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-19-(D-phenylalanylamino)-1,2-dithia-5,8,11,14,17-pentaazacycloicosane-4-carboxamide) | (4R,7S,10S,13R,16S,19R)-10-(4-aminobutyl)-16-benzyl-N-[(2R,3R)-1,3-dihydroxy-2-butanyl]-7-(1-hydroxyethyl)-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-19-(D-phenylalanylamino)-1,2-dithia-5,8,11,14,17-pentaazacycloicosane-4-carboxamide |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P279 | subclass of | ... | Q104631433 (synthetic peptide) | synthetic peptide |
| P592 | ChEMBL ID | CHEMBL262746 |
| P661 | ChemSpider ID | 339723 |
| P595 | Guide to Pharmacology Ligand ID | 2055 |
| P2057 | Human Metabolome Database ID | HMDB0255913 |
| P234 | InChI | InChI=1S/C49H66N10O10S2/c1-28(61)39(25-60)56-48(68)41-27-71-70-26-40(57-43(63)34(51)21-30-13-5-3-6-14-30)47(67)54-37(22-31-15-7-4-8-16-31)45(65)55-38(23-32-24-52-35-18-10-9-17-33(32)35)46(66)53-36(19-11-12-20-50)44(64)59-42(29(2)62)49(69)58-41/h3-10,13-18,24,28-29,34,36-42,52,60-62H,11-12,19-23,25-27,50-51H2,1-2H3,(H,53,66)(H,54,67)(H,55,65)(H,56,68)(H,57,63)(H,58,69)(H,59,64) |
| P235 | InChIKey | DEQANNDTNATYII-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD051173 |
| P662 | PubChem CID | 383414 |
| P2877 | SureChEMBL ID | 678434 |
| P2877 | SureChEMBL ID | 29454825 |
| P11089 | UniChem compound ID | 1067173 |
Why not click here or view trends?
log id: 1993204