Wikidata entity: Q27088404
C₂₀H₁₈N₄O (P274)
Quantities
| P2067 | mass | 330.148061 |
| P233 | canonical SMILES | String | CC(C1=CC=CC=C1)NC2=NC=NC3=C2C=C(N3)C4=CC=C(C=C4)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@H](C1=CC=CC=C1)NC2=NC=NC3=C2C=C(N3)C4=CC=C(C=C4)O | ??? |
| P129 | physically interacts with | ... | Q424401 (epidermal growth factor receptor) | epidermal growth factor receptor |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P592 | ChEMBL ID | CHEMBL1963502 |
| P661 | ChemSpider ID | 5293600 |
| P3117 | DSSTox substance ID | DTXSID801346629 |
| P595 | Guide to Pharmacology Ligand ID | 7642 |
| P234 | InChI | InChI=1S/C20H18N4O/c1-13(14-5-3-2-4-6-14)23-19-17-11-18(24-20(17)22-12-21-19)15-7-9-16(25)10-8-15/h2-13,25H,1H3,(H2,21,22,23,24)/t13-/m1/s1 |
| P235 | InChIKey | XRYJULCDUUATMC-CYBMUJFWSA-N |
| P11199 | Probes And Drugs ID | PD039653 |
| P662 | PubChem CID | 6918403 |
| P2877 | SureChEMBL ID | 185822 |
| P2877 | SureChEMBL ID | 177814 |
| P11089 | UniChem compound ID | 1076210 |
| P652 | UNII | 9RIE5HW38P |
Why not click here or view trends?
log id: 4052338