Wikidata entity: Q27088689
C₂₃H₂₅ClFN₅O₃ (P274)
Quantities
| P2067 | mass | 473.162996 |
| P233 | canonical SMILES | String | CNC(=O)CN1CCC(CC1)OC2=C(C=C3C(=C2)C(=NC=N3)NC4=C(C(=CC=C4)Cl)F)OC | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q424401 (epidermal growth factor receptor) | epidermal growth factor receptor |
| P129 | physically interacts with | ... | Q21104746 (Erb-b2 receptor tyrosine kinase 3) | Erb-b2 receptor tyrosine kinase 3 |
| P129 | physically interacts with | ... | Q415271 (Erb-b2 receptor tyrosine kinase 2) | Erb-b2 receptor tyrosine kinase 2 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 848942-61-0 |
| P683 | ChEBI ID | 132986 |
| P592 | ChEMBL ID | CHEMBL2408045 |
| P661 | ChemSpider ID | 9663133 |
| P715 | DrugBank ID | DB12183 |
| P8494 | DSSTOX compound identifier | DTXCID80156433 |
| P3117 | DSSTox substance ID | DTXSID50233942 |
| P232 | EC number | 642-427-0 |
| P2566 | ECHA Substance Infocard ID | 100.170.260 |
| P595 | Guide to Pharmacology Ligand ID | 7717 |
| P234 | InChI | InChI=1S/C23H25ClFN5O3/c1-26-21(31)12-30-8-6-14(7-9-30)33-20-10-15-18(11-19(20)32-2)27-13-28-23(15)29-17-5-3-4-16(24)22(17)25/h3-5,10-11,13-14H,6-9,12H2,1-2H3,(H,26,31)(H,27,28,29) |
| P235 | InChIKey | DFJSJLGUIXFDJP-UHFFFAOYSA-N |
| P11623 | NCI Drug Dictionary ID | sapitinib |
| P11199 | Probes And Drugs ID | PD010834 |
| P662 | PubChem CID | 11488320 |
| P2877 | SureChEMBL ID | 202358 |
| P2877 | SureChEMBL ID | 29728247 |
| P2877 | SureChEMBL ID | 30362790 |
| P11089 | UniChem compound ID | 24244366 |
| P652 | UNII | 3499328002 |
Why not click here or view trends?
log id: 3563795