Wikidata entity: Q27095582
C₁₉H₁₈N₂O₄S (P274)
Quantities
| P2067 | mass | 370.098728 |
| P233 | canonical SMILES | String | CCOC1=C(C=C(C=C1)C2=NC(=CS2)C3=NC(=CC=C3)C(=O)O)OCC | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21117805 (Phosphodiesterase 4A) | Phosphodiesterase 4A |
| P129 | physically interacts with | ... | Q21202200 (Phosphodiesterase 4C) | Phosphodiesterase 4C |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 145739-56-6 |
| P683 | ChEBI ID | 230391 |
| P592 | ChEMBL ID | CHEMBL332750 |
| P661 | ChemSpider ID | 2291461 |
| P715 | DrugBank ID | DB05298 |
| P8494 | DSSTOX compound identifier | DTXCID2085640 |
| P3117 | DSSTox substance ID | DTXSID00163149 |
| P595 | Guide to Pharmacology Ligand ID | 9877 |
| P2057 | Human Metabolome Database ID | HMDB0258864 |
| P234 | InChI | InChI=1S/C19H18N2O4S/c1-3-24-16-9-8-12(10-17(16)25-4-2)18-21-15(11-26-18)13-6-5-7-14(20-13)19(22)23/h5-11H,3-4H2,1-2H3,(H,22,23) |
| P235 | InChIKey | XDBHURGONHZNJF-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD008626 |
| P662 | PubChem CID | 3025803 |
| P2877 | SureChEMBL ID | 436663 |
| P11089 | UniChem compound ID | 241555 |
| P652 | UNII | S6RXB5KF56 |
Why not click here or view trends?
log id: 8346230