C₅₃H₇₂N₂O₁₂²⁺ (P274)
Quantities
| P2067 | mass | 928.5074285841804 |
| P233 | canonical SMILES | String | C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)OC)OC)OC)CCC(=O)OCCCCCOC(=O)CC[N+]4(CCC5=CC(=C(C=C5C4CC6=CC(=C(C=C6)OC)OC)OC)OC)C | ??? |
| P373 | Commons category | String | Atracurium | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21111162 (Cholinergic receptor nicotinic alpha 1 subunit) | Cholinergic receptor nicotinic alpha 1 subunit |
| P129 | physically interacts with | ... | Q21111163 (Cholinergic receptor nicotinic gamma subunit) | Cholinergic receptor nicotinic gamma subunit |
| P129 | physically interacts with | ... | Q21111178 (Cholinergic receptor nicotinic epsilon subunit) | Cholinergic receptor nicotinic epsilon subunit |
| P129 | physically interacts with | ... | Q21111180 (Cholinergic receptor nicotinic delta subunit) | Cholinergic receptor nicotinic delta subunit |
| P769 | significant drug interaction | ... | Q192717 (streptomycin) | streptomycin |
| P769 | significant drug interaction | ... | Q408529 (amikacin) | amikacin |
| P769 | significant drug interaction | ... | Q424972 (prednisone) | prednisone |
| P769 | significant drug interaction | ... | Q416132 (betamethasone) | betamethasone |
| P769 | significant drug interaction | ... | Q417222 (methylprednisolone) | methylprednisolone |
| P769 | significant drug interaction | ... | Q422252 (dexamethasone) | dexamethasone |
| P769 | significant drug interaction | ... | Q1074056 (triamcinolone) | triamcinolone |
| P769 | significant drug interaction | ... | Q1758380 (tobramycin) | tobramycin |
| P769 | significant drug interaction | ... | Q11426176 (prednisolone) | prednisolone |
| P279 | subclass of | ... | Q5272330 (dication) | dication |
| P279 | subclass of | ... | Q43457636 (organic cation) | organic cation |
| P231 | CAS Registry Number | 64228-79-1 |
| P683 | ChEBI ID | 2914 |
| P592 | ChEMBL ID | CHEMBL1360 |
| P661 | ChemSpider ID | 43067 |
| P661 | ChemSpider ID | 21240513 |
| P661 | ChemSpider ID | 21240968 |
| P11198 | DrugCentral ID | 259 |
| P8494 | DSSTOX compound identifier | DTXCID7023726 |
| P3117 | DSSTox substance ID | DTXSID9043726 |
| P595 | Guide to Pharmacology Ligand ID | 9537 |
| P2057 | Human Metabolome Database ID | HMDB0014870 |
| P234 | InChI | InChI=1S/C53H72N2O12/c1-54(22-18-38-32-48(62-7)50(64-9)34-40(38)42(54)28-36-14-16-44(58-3)46(30-36)60-5)24-20-52(56)66-26-12-11-13-27-67-53(57)21-25-55(2)23-19-39-33-49(63-8)51(65-10)35-41(39)43(55)29-37-15-17-45(59-4)47(31-37)61-6/h14-17,30-35,42-43H,11-13,18-29H2,1-10H3/q+2 |
| P235 | InChIKey | YXSLJKQTIDHPOT-UHFFFAOYSA-N |
| P665 | KEGG ID | C07548 |
| P486 | MeSH descriptor ID | D001279 |
| P672 | MeSH tree code | D03.633.100.531.085.061 |
| P11199 | Probes And Drugs ID | PD013187 |
| P662 | PubChem CID | 47319 |
| P1579 | Reaxys registry number | 1523633 |
| P3345 | RxNorm CUI | 1218 |
| P2877 | SureChEMBL ID | 7773510 |
| P2877 | SureChEMBL ID | 29462335 |
| P11089 | UniChem compound ID | 266904 |
Why not click here or view trends?
log id: 1884839