Wikidata entity: Q27098384
C₉H₁₆O₂ (P274)
Quantities
| P2067 | mass | 156.11503 |
| P233 | canonical SMILES | String | CCCC(=O)CC(=O)CCC | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P361 | part of | ... | Q22320566 (beta-diketone hydrolase activity) | beta-diketone hydrolase activity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 14090-88-1 |
| P683 | ChEBI ID | 16111 |
| P661 | ChemSpider ID | 24641 |
| P8494 | DSSTOX compound identifier | DTXCID5034565 |
| P3117 | DSSTox substance ID | DTXSID2065703 |
| P232 | EC number | 237-938-7 |
| P2566 | ECHA Substance Infocard ID | 100.034.475 |
| P234 | InChI | InChI=1S/C9H16O2/c1-3-5-8(10)7-9(11)6-4-2/h3-7H2,1-2H3 |
| P235 | InChIKey | ZDYWPVCQPUPOJV-UHFFFAOYSA-N |
| P665 | KEGG ID | C02445 |
| P2064 | KNApSAcK ID | C00053571 |
| P662 | PubChem CID | 26454 |
| P1579 | Reaxys registry number | 1757685 |
| P2877 | SureChEMBL ID | 1701664 |
| P11089 | UniChem compound ID | 1072531 |
| P652 | UNII | 75JZE9JA5F |
Why not click here or view trends?
log id: 5178369