| P233 | canonical SMILES | CC(=CCC1=C(C=CC(=C1)C=C2C(=C(C(=O)O2)C3=CC(=C(C=C3)O)CC=C(C)C)O)O)C |
| P231 | CAS Registry Number | 57744-69-1 |
| P683 | ChEBI ID | 17099 |
| P661 | ChemSpider ID | 21864823 |
| P3117 | DSSTox substance ID | DTXSID701102177 |
| P234 | InChI | InChI=1S/C27H28O5/c1-16(2)5-8-19-13-18(7-11-22(19)28)14-24-26(30)25(27(31)32-24)21-10-12-23(29)20(15-21)9-6-17(3)4/h5-7,10-15,28-30H,8-9H2,1-4H3/b24-14- |
| P235 | InChIKey | LFDYHAWYVIBCDT-OYKKKHCWSA-N |
| P2017 | isomeric SMILES | CC(=CCC1=C(C=CC(=C1)/C=C\2/C(=C(C(=O)O2)C3=CC(=C(C=C3)O)CC=C(C)C)O)O)C |
| P665 | KEGG ID | C02008 |
| P7746 | Natural Product Atlas ID | NPA006062 |
| P662 | PubChem CID | 54675755 |
| P11089 | UniChem compound ID | 1068990 |
| P652 | UNII | Y35DVS6J4Z |
| P703 | found in taxon | Aspergillus terreus | Q3798237 |
| Aspergillus flavipes | Q6650998 | ||
| P2067 | mass | 432.193674 |
| Q37323144 | Application of an efficient gene targeting system linking secondary metabolites to their biosynthetic genes in Aspergillus terreus. |
| Q35950974 | Four butyrolactones and diverse bioactive secondary metabolites from terrestrial Aspergillus flavipes MM2: isolation and structure determination. |
| Q105023149 | New metabolites from Aspergillus terreus related to the biosynthesis of aspulvinones |
| Q34269509 | Purification and characterization of dimethylallyl pyrophosphate: aspulvinone dimethylallyltransferase from Aspergillus terreus |
Search more.