Wikidata entity: Q27102778
C₈H₆O₆²⁻ (P274)
Quantities
| P2067 | mass | 198.01753507182002 |
| P233 | canonical SMILES | String | C(C(=O)CC(=O)[O-])C(=O)C=CC(=O)[O-] | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C(C(=O)CC(=O)[O-])C(=O)/C=C/C(=O)[O-] | ??? |
| P361 | part of | ... | Q14914205 (fumarylacetoacetase activity) | fumarylacetoacetase activity |
| P361 | part of | ... | Q22324090 (maleylacetoacetate isomerase activity) | maleylacetoacetate isomerase activity |
| P279 | subclass of | ... | Q71653081 (fatty acid anion) | fatty acid anion |
| P279 | subclass of | ... | Q109911294 (biogenic acyclic ketone) | biogenic acyclic ketone |
| P2868 | subject has role | ... | Q3333419 (primary metabolite) | primary metabolite |
| P683 | ChEBI ID | 18034 |
| P661 | ChemSpider ID | 4573657 |
| P234 | InChI | InChI=1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/p-2/b2-1+ |
| P235 | InChIKey | GACSIVHAIFQKTC-OWOJBTEDSA-L |
| P662 | PubChem CID | 5459934 |
| P11089 | UniChem compound ID | 1105790 |
Why not click here or view trends?
log id: 7137604