Wikidata entity: Q27103561
C₃₀H₂₁FeN₃O₁₅³⁻ (P274)
Quantities
| P2067 | mass | 719.03385021173 |
| P233 | canonical SMILES | String | C1C(C(=O)OCC(C(=O)OCC(C(=O)O1)NC(=O)C2=C(C(=CC=C2)[O-])[O-])NC(=O)C3=C(C(=CC=C3)[O-])[O-])NC(=O)C4=C(C(=CC=C4)[O-])[O-].[Fe+3] | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1[C@@H](C(=O)OC[C@@H](C(=O)OC[C@@H](C(=O)O1)NC(=O)C2=C(C(=CC=C2)[O-])[O-])NC(=O)C3=C(C(=CC=C3)[O-])[O-])NC(=O)C4=C(C(=CC=C4)[O-])[O-].[Fe+3] | ??? |
| P361 | part of | ... | Q22292197 (ferric-enterobactin import into cell) | ferric-enterobactin import into cell |
| P361 | part of | ... | Q22320636 (ABC-type ferric-enterobactin transporter activity) | ABC-type ferric-enterobactin transporter activity |
| P361 | part of | ... | Q22324599 (ferric enterobactin:proton symporter activity) | ferric enterobactin:proton symporter activity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 61481-53-6 |
| P683 | ChEBI ID | 28199 |
| P661 | ChemSpider ID | 13177012 |
| P661 | ChemSpider ID | 21864908 |
| P3117 | DSSTox substance ID | DTXSID201343360 |
| P1578 | Gmelin number | 885856 |
| P234 | InChI | InChI=1S/C30H27N3O15.Fe/c34-19-7-1-4-13(22(19)37)25(40)31-16-10-46-29(44)18(33-27(42)15-6-3-9-21(36)24(15)39)12-48-30(45)17(11-47-28(16)43)32-26(41)14-5-2-8-20(35)23(14)38;/h1-9,16-18,34-39H,10-12H2,(H,31,40)(H,32,41)(H,33,42);/q;+3/p-6/t16-,17-,18-;/m0./s1 |
| P235 | InChIKey | NGILTSZTOFYVBF-UVJOBNTFSA-H |
| P662 | PubChem CID | 16048613 |
| P2877 | SureChEMBL ID | 29687367 |
| P11089 | UniChem compound ID | 1097752 |
| P652 | UNII | AF1D66MEGV |
Why not click here or view trends?
log id: 1791097