Wikidata entity: Q27104099
C₁₁H₁₁O₅⁻ (P274)
Quantities
| P2067 | mass | 223.060648 |
| P233 | canonical SMILES | String | COC1=CC(=CC(=C1[O-])OC)C=CC(=O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | COC1=CC(=CC(=C1[O-])OC)/C=C/C(=O)O | ??? |
| P361 | part of | ... | Q22283153 (sinapate metabolic process) | sinapate metabolic process |
| P361 | part of | ... | Q22283154 (sinapate biosynthetic process) | sinapate biosynthetic process |
| P361 | part of | ... | Q22320385 (sinapine esterase activity) | sinapine esterase activity |
| P361 | part of | ... | Q22321656 (sinapate 1-glucosyltransferase activity) | sinapate 1-glucosyltransferase activity |
| P279 | subclass of | ... | Q27146675 ((EZ)-sinapic acid) | (EZ)-sinapic acid |
| P683 | ChEBI ID | 30023 |
| P661 | ChemSpider ID | 4573878 |
| P234 | InChI | InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/p-1/b4-3+ |
| P235 | InChIKey | PCMORTLOPMLEFB-ONEGZZNKSA-M |
| P662 | PubChem CID | 54710960 |
| P11089 | UniChem compound ID | 1103094 |
Why not click here or view trends?
log id: 5866430