| type of chemical entity | Q113145171 |
| vetaspiradiene | Q82079006 |
| spirovetivanes | Q108294391 |
| biogenic aliphatic hydrocarbon | Q109910560 |
| P233 | canonical SMILES | CC1CCC=C(C12CCC(C2)C(=C)C)C |
| P683 | ChEBI ID | 46971 |
| P661 | ChemSpider ID | 24605325 |
| P234 | InChI | InChI=1S/C15H24/c1-11(2)14-8-9-15(10-14)12(3)6-5-7-13(15)4/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14-,15-/m1/s1 |
| P235 | InChIKey | WEZDOYDDKIHCLM-RBSFLKMASA-N |
| P2017 | isomeric SMILES | C[C@@H]1CCC=C([C@]12CC[C@H](C2)C(=C)C)C |
| P2064 | KNApSAcK ID | C00007637 |
| P3636 | PDB ligand ID | 6BW |
| P638 | PDB structure ID | 5IKH |
| P662 | PubChem CID | 14355861 |
| P11089 | UniChem compound ID | 1104081 |
| P703 | found in taxon | Lepechinia bullata | Q15338427 |
| P2067 | mass | 204.188 | |
| P361 | part of | vetispiradiene synthase activity | Q22324425 |
| P3364 | stereoisomer of | hinesene | Q67879919 |
| (3S,5S,6R)-6,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-9-ene | Q76100269 | ||
| vetispiradiene | Q105303700 |
| Q76100269 | (3S,5S,6R)-6,10-dimethyl-3-prop-1-en-2-ylspiro[4.5]dec-9-ene |
| Q67879919 | hinesene |
| Q105303700 | vetispiradiene |
| Q105130245 | (−)-Spirolepechinene, a spirosesquiterpene from Lepechinia bullata (Lamiaceae) |
| Q27712766 | Biosynthetic potential of sesquiterpene synthases: product profiles of Egyptian Henbane premnaspirodiene synthase and related mutants |
| Q51744018 | Building terpene production platforms in yeast. |
| Q28299400 | Cloning and bacterial expression of a sesquiterpene cyclase from Hyoscyamus muticus and its molecular comparison to related terpene cyclases |
| Q24646983 | Functional characterization of premnaspirodiene oxygenase, a cytochrome P450 catalyzing regio- and stereo-specific hydroxylations of diverse sesquiterpene substrates |
| Q44264510 | Probing sesquiterpene hydroxylase activities in a coupled assay with terpene synthases |
| Q33904011 | Stereochemistry and deuterium isotope effects associated with the cyclization-rearrangements catalyzed by tobacco epiaristolochene and hyoscyamus premnaspirodiene synthases, and the chimeric CH4 hybrid cyclase |
| Q22324425 | vetispiradiene synthase activity | has part(s) | P527 |