Wikidata entity: Q27107702
C₁₁H₁₆ClNO (P274)
Quantities
| P2067 | mass | 213.092042 |
| P233 | canonical SMILES | String | CC1C(OCCN1)C2=CC=CC=C2.Cl | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q2271947 (solute carrier family 6 member 3) | solute carrier family 6 member 3 |
| P129 | physically interacts with | ... | Q7050954 (Solute carrier family 6 member 2) | Solute carrier family 6 member 2 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1707-14-8 |
| P683 | ChEBI ID | 8068 |
| P592 | ChEMBL ID | CHEMBL1200483 |
| P661 | ChemSpider ID | 83204 |
| P8494 | DSSTOX compound identifier | DTXCID8027799 |
| P3117 | DSSTox substance ID | DTXSID0047822 |
| P232 | EC number | 216-950-6 |
| P2566 | ECHA Substance Infocard ID | 100.015.409 |
| P234 | InChI | InChI=1S/C11H15NO.ClH/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10;/h2-6,9,11-12H,7-8H2,1H3;1H |
| P235 | InChIKey | VJNXVAVKCZJOFQ-UHFFFAOYSA-N |
| P665 | KEGG ID | D05454 |
| P665 | KEGG ID | C07433 |
| P2115 | NDF-RT ID | N0000147332 |
| P2840 | NSC number | 405728 |
| P11199 | Probes And Drugs ID | PD052051 |
| P662 | PubChem CID | 92159 |
| P662 | PubChem CID | 91994255 |
| P3345 | RxNorm CUI | 203198 |
| P2877 | SureChEMBL ID | 121536 |
| P2877 | SureChEMBL ID | 22462307 |
| P2892 | UMLS CUI | C0700556 |
| P11089 | UniChem compound ID | 547985 |
Why not click here or view trends?
log id: 10216031