Wikidata entity: Q27109279
C₅H₉NO₃ (P274)
Quantities
| P2067 | mass | 131.058243 |
| P233 | canonical SMILES | String | C1CNC(C1O)C(=O)O | ??? |
| P31 | instance of | ... | Q15711994 (group of isomeric entities) | group of isomeric entities |
| P2017 | isomeric SMILES | String | C1CN[C@@H](C1O)C(=O)O | ??? |
| P361 | part of | ... | Q15311953 (peptidyl-proline hydroxylation to 3-hydroxy-L-proline) | peptidyl-proline hydroxylation to 3-hydroxy-L-proline |
| P279 | subclass of | ... | Q4030651 (3-hydroxyproline) | 3-hydroxyproline |
| P279 | subclass of | ... | Q17325781 (pyrrolidine alkaloid) | pyrrolidine alkaloid |
| P231 | CAS Registry Number | 567-36-2 |
| P683 | ChEBI ID | 20056 |
| P661 | ChemSpider ID | 132893 |
| P8494 | DSSTOX compound identifier | DTXCID40227719 |
| P3117 | DSSTox substance ID | DTXSID20276427 |
| P234 | InChI | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3?,4-/m0/s1 |
| P235 | InChIKey | BJBUEDPLEOHJGE-BKLSDQPFSA-N |
| P662 | PubChem CID | 150779 |
| P2877 | SureChEMBL ID | 8088 |
| P11089 | UniChem compound ID | 23048676 |
Why not click here or view trends?
log id: 5018691