| type of chemical entity | Q113145171 |
| gibberellins | Q331818 |
| C20-gibberellin | Q108409073 |
| P233 | canonical SMILES | CC1(C(CCC2(C1C(C34C2CCC(C3)C(=C)C4)C(=O)O)C=O)O)C(=O)O |
| P231 | CAS Registry Number | 38076-57-2 |
| P683 | ChEBI ID | 29595 |
| P661 | ChemSpider ID | 391669 |
| P8494 | DSSTOX compound identifier | DTXCID50283184 |
| P3117 | DSSTox substance ID | DTXSID00332090 |
| P234 | InChI | InChI=1S/C20H26O6/c1-10-7-20-8-11(10)3-4-12(20)19(9-21)6-5-13(22)18(2,17(25)26)15(19)14(20)16(23)24/h9,11-15,22H,1,3-8H2,2H3,(H,23,24)(H,25,26)/t11-,12+,13+,14-,15-,18-,19-,20+/m1/s1 |
| P235 | InChIKey | JZBLVVPDEDCVQA-SQLMURCQSA-N |
| P2017 | isomeric SMILES | C[C@]1([C@H](CC[C@@]2([C@@H]1[C@@H]([C@]34[C@H]2CC[C@H](C3)C(=C)C4)C(=O)O)C=O)O)C(=O)O |
| P665 | KEGG ID | C11862 |
| P2064 | KNApSAcK ID | C00000036 |
| P2063 | LIPID MAPS ID | LMPR0104170019 |
| P662 | PubChem CID | 443455 |
| P1579 | Reaxys registry number | 2955378 |
| P11089 | UniChem compound ID | 1067498 |
| P703 | found in taxon | Arabidopsis thaliana | Q158695 |
| Cucurbita maxima | Q161180 | ||
| Psilotum nudum | Q1197925 | ||
| Dioscorea polystachya | Q5279593 | ||
| Gibberella fujikuroi | Q288175 | ||
| Dioscorea oppositifolia | Q1196309 | ||
| Fusarium fujikuroi | Q10500328 | ||
| P2067 | mass | 362.172939 | |
| P3364 | stereoisomer of | (1S,2S,3R,4S,5S,8R,9R,12S)-8-formyl-5-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid | Q105137333 |
| P2868 | subject has role | primary metabolite | Q3333419 |
| Q86657539 | Accumulation of C19-gibberellins in the gibberellin-insensitive dwarf mutantgai ofArabidopsis thaliana (L.) Heynh |
| Q47732124 | Biosynthesis of 12α-and 13-hydroxylated gibberellins in a cell-free system from Cucurbita maxima endosperm and the identification of new endogenous gibberellins |
| Q69707063 | Fungal products. Part IX. Gibberellins A16, A36, A37, A41, and A42 from Gibberella fujikuroi |
| Q47732112 | Gibberellin biosynthesis in cell-free extracts from developing Cucurbita maxima embryos and the identification of new endogenous gibberellins. |
| Q54470535 | Identification of Endogenous Gibberellins in Dormant Bulbils of Chinese Yam, Dioscorea opposita. |
| Q104992272 | Identification of ga36 in psilotum nudum |
| Q105137333 | (1S,2S,3R,4S,5S,8R,9R,12S)-8-formyl-5-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid | stereoisomer of | P3364 |
Search more.