Wikidata entity: Q27116225
C₁₉H₁₆Cl₂N₃NaO₅S (P274)
Quantities
| P2067 | mass | 491.008541 |
| P233 | canonical SMILES | String | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)NC3C4N(C3=O)C(C(S4)(C)C)C(=O)[O-].[Na+] | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-].[Na+] | ??? |
| P2175 | medical condition treated | ... | Q173022 (bronchitis) | bronchitis |
| P2175 | medical condition treated | ... | Q12192 (pneumonia) | pneumonia |
| P2175 | medical condition treated | ... | Q727028 (bacterial infectious disease) | bacterial infectious disease |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 343-55-5 |
| P683 | ChEBI ID | 34691 |
| P592 | ChEMBL ID | CHEMBL26570 |
| P661 | ChemSpider ID | 58237 |
| P715 | DrugBank ID | DBSALT000495 |
| P8494 | DSSTOX compound identifier | DTXCID20110352 |
| P3117 | DSSTox substance ID | DTXSID60187861 |
| P232 | EC number | 206-444-3 |
| P2566 | ECHA Substance Infocard ID | 100.005.859 |
| P234 | InChI | InChI=1S/C19H17Cl2N3O5S.Na/c1-7-10(12(23-29-7)11-8(20)5-4-6-9(11)21)15(25)22-13-16(26)24-14(18(27)28)19(2,3)30-17(13)24;/h4-6,13-14,17H,1-3H3,(H,22,25)(H,27,28);/q;+1/p-1/t13-,14+,17-;/m1./s1 |
| P235 | InChIKey | GXOMMGAFBINOJY-SLINCCQESA-M |
| P665 | KEGG ID | C13756 |
| P11199 | Probes And Drugs ID | PD002381 |
| P662 | PubChem CID | 23667628 |
| P662 | PubChem CID | 101327128 |
| P1579 | Reaxys registry number | 4778711 |
| P2877 | SureChEMBL ID | 41516 |
| P11089 | UniChem compound ID | 574185 |
| P652 | UNII | 4CKS6MOL6Z |
Why not click here or view trends?
log id: 1806300