Wikidata entity: Q27117247
C₆H₁₂O₆ (P274)
Quantities
| P2067 | mass | 180.063388 |
| P233 | canonical SMILES | String | C(C1C(C(C(C(O1)O)O)O)O)O | ??? |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P2017 | isomeric SMILES | String | C([C@H]1[C@@H]([C@@H]([C@@H](C(O1)O)O)O)O)O | ??? |
| P279 | subclass of | ... | Q100388742 (L-allose) | L-allose |
| P279 | subclass of | ... | Q100417942 (allopyranose) | allopyranose |
| P231 | CAS Registry Number | 39392-63-7 |
| P683 | ChEBI ID | 37741 |
| P661 | ChemSpider ID | 13076841 |
| P3117 | DSSTox substance ID | DTXSID601319074 |
| P2057 | Human Metabolome Database ID | HMDB0001151 |
| P234 | InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5-,6?/m0/s1 |
| P235 | InChIKey | WQZGKKKJIJFFOK-HOWGCPQDSA-N |
| P662 | PubChem CID | 12285879 |
| P4964 | SPLASH | splash10-0a4i-9000000000-b1bddab3816e1286ec8d |
| P4964 | SPLASH | splash10-0a4i-9000000000-e6f172b0f12150f5bb00 |
| P2877 | SureChEMBL ID | 29367780 |
| P11089 | UniChem compound ID | 1102431 |
Why not click here or view trends?
log id: 4056892