Wikidata entity: Q27120751
C₅H₁₀O₅ (P274)
Quantities
| P2067 | mass | 150.053 |
| P233 | canonical SMILES | String | C(C1C(C(C(O1)O)O)O)O | ??? |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P2017 | isomeric SMILES | String | C([C@H]1[C@@H]([C@@H](C(O1)O)O)O)O | ??? |
| P279 | subclass of | ... | Q10920081 (ribofuranose) | ribofuranose |
| P279 | subclass of | ... | Q85553776 (L-ribose) | L-ribose |
| P231 | CAS Registry Number | 41546-21-8 |
| P683 | ChEBI ID | 47000 |
| P661 | ChemSpider ID | 9979598 |
| P8494 | DSSTOX compound identifier | DTXCID00423836 |
| P3117 | DSSTox substance ID | DTXSID90473022 |
| P234 | InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5?/m0/s1 |
| P235 | InChIKey | HMFHBZSHGGEWLO-OWMBCFKOSA-N |
| P662 | PubChem CID | 11804933 |
| P1579 | Reaxys registry number | 1904879 |
| P2877 | SureChEMBL ID | 532483 |
| P11089 | UniChem compound ID | 1104400 |
Why not click here or view trends?
log id: 6479756