Wikidata entity: Q27122483
C₁₆H₂₅N₃O₈S (P274)
Quantities
| P2067 | mass | 419.136 |
| P233 | canonical SMILES | String | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=C(C=C3)O)N)C(=O)O)C.O.O.O | ??? |
| P1889 | different from | ... | Q201928 (amoxicillin) | amoxicillin |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C.O.O.O | ??? |
| P279 | subclass of | ... | Q126612643 (Amoxicillin Ttrihydrate) | Amoxicillin Ttrihydrate |
| P231 | CAS Registry Number | 61336-70-7 |
| P683 | ChEBI ID | 51254 |
| P661 | ChemSpider ID | 56611 |
| P8494 | DSSTOX compound identifier | DTXCID502599 |
| P3117 | DSSTox substance ID | DTXSID2022599 |
| P232 | EC number | 612-127-4 |
| P2566 | ECHA Substance Infocard ID | 100.108.948 |
| P234 | InChI | InChI=1S/C16H19N3O5S.3H2O/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;;;/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);3*1H2/t9-,10-,11+,14-;;;/m1.../s1 |
| P235 | InChIKey | MQXQVCLAUDMCEF-CWLIKTDRSA-N |
| P665 | KEGG ID | D00229 |
| P11199 | Probes And Drugs ID | PD017214 |
| P662 | PubChem CID | 62883 |
| P1579 | Reaxys registry number | 7507120 |
| P2877 | SureChEMBL ID | 41368 |
| P11089 | UniChem compound ID | 1075442 |
| P652 | UNII | 804826J2HU |
Why not click here or view trends?
log id: 9684821