type of chemical entity | Q113145171 |
N(6)-(2,4-dinitrophenyl)lysine | Q27123948 |
P233 | canonical SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCCCC(C(=O)O)N |
P231 | CAS Registry Number | 1094-76-4 |
P683 | ChEBI ID | 53080 |
P592 | ChEMBL ID | CHEMBL2028905 |
P661 | ChemSpider ID | 58579 |
P8494 | DSSTOX compound identifier | DTXCID201340192 |
P3117 | DSSTox substance ID | DTXSID10911153 |
P4168 | IEDB Epitope ID | 114088 |
P234 | InChI | InChI=1S/C12H16N4O6/c13-9(12(17)18)3-1-2-6-14-10-5-4-8(15(19)20)7-11(10)16(21)22/h4-5,7,9,14H,1-3,6,13H2,(H,17,18)/t9-/m0/s1 |
P235 | InChIKey | OFKKPUNNTZKBSR-VIFPVBQESA-N |
P2017 | isomeric SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCCC[C@@H](C(=O)O)N |
P662 | PubChem CID | 65068 |
40488045 | ||
P1579 | Reaxys registry number | 2822998 |
P652 | UNII | S6TD66F98C |
P2067 | mass | 312.107 |
Q28330114 | Induction of immune tolerance by free unreactive haptens |
Q42248842 | Intestinal absorption of dinitrophenyl-lysine and effect of immunization with dinitrophenylated bovine serum albumin |
Q39714498 | Rapid detoxification of epsilon-dinitrophenylated-lysine of dinitrophenylated leucocytes, the anti-leukaemic immunogen |
Q34178850 | Real-time measurement of spontaneous antigen-antibody dissociation |
Q73877065 | The conversion from the dehydrogenase type to the oxidase type of rat liver xanthine dehydrogenase by modification of cysteine residues with fluorodinitrobenzene |
Q43205446 | The specificity of cross‐reactivity: Promiscuous antibody binding involves specific hydrogen bonds rather than nonspecific hydrophobic stickiness |
Search more.