Wikidata entity: Q27124944
C₂₁H₂₆N₇O₁₇P₃⁴⁻ (P274)
Quantities
| P2067 | mass | 741.0619965816401 |
| P233 | canonical SMILES | String | C1C=CN(C=C1C(=O)N)C2C(C(C(O2)COP(=O)([O-])OP(=O)([O-])OCC3C(C(C(O3)N4C=NC5=C4N=CN=C5N)OP(=O)([O-])[O-])O)O)O | ??? |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P2017 | isomeric SMILES | String | C1C=CN(C=C1C(=O)N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)([O-])OC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=NC5=C4N=CN=C5N)OP(=O)([O-])[O-])O)O)O | ??? |
| P361 | part of | ... | Q14864131 (NADPH binding) | NADPH binding |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q3333419 (primary metabolite) | primary metabolite |
Why not click here or view trends?
log id: 5812001