Wikidata entity: Q27126952
C₁₂H₁₇N₅O₄ (P274)
Quantities
| P2067 | mass | 295.128054 |
| P3780 | active ingredient in | ... | Q29004884 (Baraclude) | Baraclude |
| P233 | canonical SMILES | String | C=C1C(CC(C1CO)O)N2C=NC3=C2NC(=NC3=O)N.O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | O.NC1=NC2=C(N=CN2[C@H]3C[C@H](O)[C@@H](CO)C3=C)C(=O)N1 | ??? |
| P2175 | medical condition treated | ... | Q147778 (liver cirrhosis) | liver cirrhosis |
| P2175 | medical condition treated | ... | Q6853 (hepatitis B) | hepatitis B |
| P2175 | medical condition treated | ... | Q55779876 (chronic hepatitis B) | chronic hepatitis B |
| P1748 | NCI Thesaurus ID | String | C65513 | ??? |
| P279 | subclass of | ... | Q2689559 (nucleoside analogue) | nucleoside analogue |
| P2868 | subject has role | ... | Q421559 (reverse-transcriptase inhibitor) | reverse-transcriptase inhibitor |
| P2868 | subject has role | ... | Q40207875 (antiviral agent) | antiviral agent |
| P8072 | CAB ID | 146094 |
| P231 | CAS Registry Number | 209216-23-9 |
| P683 | ChEBI ID | 59902 |
| P661 | ChemSpider ID | 10482312 |
| P715 | DrugBank ID | DBSALT001748 |
| P8494 | DSSTOX compound identifier | DTXCID001371561 |
| P3117 | DSSTox substance ID | DTXSID00943185 |
| P232 | EC number | 606-668-5 |
| P2566 | ECHA Substance Infocard ID | 100.116.642 |
| P234 | InChI | InChI=1S/C12H15N5O3.H2O/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20;/h4,6-8,18-19H,1-3H2,(H3,13,15,16,20);1H2/t6-,7-,8-;/m0./s1 |
| P235 | InChIKey | YXPVEXCTPGULBZ-WQYNNSOESA-N |
| P665 | KEGG ID | D04008 |
| P11199 | Probes And Drugs ID | PD011040 |
| P662 | PubChem CID | 16052026 |
| P662 | PubChem CID | 135526609 |
| P3345 | RxNorm CUI | 306266 |
| P2877 | SureChEMBL ID | 28647 |
| P652 | UNII | 5968Y6H45M |
Why not click here or view trends?
log id: 2183400