C₅H₅O₃⁻ (P274)
Quantities
| P2067 | mass | 113.023869 |
| P233 | canonical SMILES | String | C=CC=C(C(=O)O)[O-] | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C=C/C=C(\C(=O)O)/[O-] | ??? |
| P361 | part of | ... | Q22320565 (2-hydroxy-6-oxonona-2,4,7-trienedioate hydrolase activity) | 2-hydroxy-6-oxonona-2,4,7-trienedioate hydrolase activity |
| P361 | part of | ... | Q22320571 (2-hydroxy-6-oxonona-2,4-dienedioate hydrolase activity) | 2-hydroxy-6-oxonona-2,4-dienedioate hydrolase activity |
| P361 | part of | ... | Q24508159 (2-hydroxy-6-oxo-6-(2'-aminophenyl)-hexa-2,4dienoate hydrolase activity) | 2-hydroxy-6-oxo-6-(2'-aminophenyl)-hexa-2,4dienoate hydrolase activity |
| P279 | subclass of | ... | Q27103023 (2-hydroxypenta-2,4-dienoic acid) | 2-hydroxypenta-2,4-dienoic acid |
| P683 | ChEBI ID | 60886 |
| P661 | ChemSpider ID | 7822016 |
| P234 | InChI | InChI=1S/C5H6O3/c1-2-3-4(6)5(7)8/h2-3,6H,1H2,(H,7,8)/p-1/b4-3+ |
| P235 | InChIKey | VHTQQDXPNUTMNB-ONEGZZNKSA-M |
| P662 | PubChem CID | 54675827 |
| P11089 | UniChem compound ID | 1100365 |
Why not click here or view trends?
log id: 7005753