Wikidata entity: Q27131083
C₃₁H₅₀N₇O₁₇P₃S⁴⁻ (P274)
Quantities
| P2067 | mass | 917.2218683496399 |
| P233 | canonical SMILES | String | CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC1C(C(C(O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)([O-])[O-])O | ??? |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P2017 | isomeric SMILES | String | CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)([O-])[O-])O | ??? |
| P361 | part of | ... | Q24511346 (decanoate-CoA ligase activity) | decanoate-CoA ligase activity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
Why not click here or view trends?
log id: 5583965