Wikidata entity: Q27131493
C₁₃H₁₀N₂O₄ (P274)
Quantities
| P2067 | mass | 258.064 |
| P233 | canonical SMILES | String | C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC=C3C2=O | ??? |
| P373 | Commons category | String | (S)-Thalidomide | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1CC(=O)NC(=O)[C@H]1N2C(=O)C3=CC=CC=C3C2=O | ??? |
| P2175 | medical condition treated | ... | Q467635 (multiple myeloma) | multiple myeloma |
| P2175 | medical condition treated | ... | Q6527832 (lepromatous leprosy) | lepromatous leprosy |
| P3364 | stereoisomer of | ... | Q27131492 ((R)-thalidomide) | (R)-thalidomide |
| P279 | subclass of | ... | Q203174 (thalidomide) | thalidomide |
| P231 | CAS Registry Number | 841-67-8 |
| P6852 | CCDC Number | 628395 |
| P683 | ChEBI ID | 61918 |
| P592 | ChEMBL ID | CHEMBL426123 |
| P661 | ChemSpider ID | 83188 |
| P11375 | CSD Refcode | THALID11 |
| P8494 | DSSTOX compound identifier | DTXCID9026972 |
| P3117 | DSSTox substance ID | DTXSID1046972 |
| P232 | EC number | 635-910-2 |
| P2566 | ECHA Substance Infocard ID | 100.163.755 |
| P234 | InChI | InChI=1S/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17)/t9-/m0/s1 |
| P235 | InChIKey | UEJJHQNACJXSKW-VIFPVBQESA-N |
| P2840 | NSC number | 91730 |
| P3636 | PDB ligand ID | EF2 |
| P638 | PDB structure ID | 4TZC |
| P638 | PDB structure ID | 5AMH |
| P638 | PDB structure ID | 4V2Y |
| P638 | PDB structure ID | 5AMK |
| P638 | PDB structure ID | 5AMI |
| P638 | PDB structure ID | 5AMJ |
| P638 | PDB structure ID | 4CI1 |
| P638 | PDB structure ID | 4V32 |
| P11199 | Probes And Drugs ID | PD130798 |
| P662 | PubChem CID | 92142 |
| P1579 | Reaxys registry number | 5756816 |
| P2877 | SureChEMBL ID | 455269 |
| P11089 | UniChem compound ID | 361980 |
| P652 | UNII | TG87FSR590 |
Why not click here or view trends?
log id: 2680413