| P233 | canonical SMILES | CC1=C(C(=CC(=C1OC)OC)OC)C#CC(=C)C |
| P683 | ChEBI ID | 65414 |
| P592 | ChEMBL ID | CHEMBL229169 |
| P661 | ChemSpider ID | 20568906 |
| P234 | InChI | InChI=1S/C15H18O3/c1-10(2)7-8-12-11(3)15(18-6)14(17-5)9-13(12)16-4/h9H,1H2,2-6H3 |
| P235 | InChIKey | CPPLWBNAWKMJON-UHFFFAOYSA-N |
| P2064 | KNApSAcK ID | C00038467 |
| P7746 | Natural Product Atlas ID | NPA001842 |
| P662 | PubChem CID | 16737471 |
| P1579 | Reaxys registry number | 11184575 |
| P11089 | UniChem compound ID | 287485 |
| P703 | found in taxon | Taiwanofungus camphoratus | Q15636116 |
| P2067 | mass | 246.126 |
| Q34636030 | Anti-inflammatory benzenoids from Antrodia camphorata. |
| Q43175615 | Antrocamphin A, an anti-inflammatory principal from the fruiting body of Taiwanofungus camphoratus , and its mechanisms |
| Q34459302 | Biologically active constituents from the fruiting body of Taiwanofungus camphoratus |
| Q82509943 | First total synthesis of antrocamphin A and its analogs as anti-inflammatory and anti-platelet aggregation agents |
Search more.