| group of stereoisomers | Q59199015 |
| zhankuic acid | Q16939291 |
| (6R)-6-[(6S)-6,9a,11a-trimethyl-4,7,10-trioxo-1H,2H,3H,3aH,5H,5aH,6H,8H,9H,11H-cyclopenta[a]phenanthren-1-yl]-2-methyl-3-methylideneheptanoic acid | Q104990268 |
| P233 | canonical SMILES | CC1C2CC(=O)C3=C(C2(CCC1=O)C)C(=O)CC4(C3CCC4C(C)CCC(=C)C(C)C(=O)O)C |
| P231 | CAS Registry Number | 173327-15-6 |
| P683 | ChEBI ID | 66503 |
| P592 | ChEMBL ID | CHEMBL1644789 |
| P661 | ChemSpider ID | 8180422 |
| P8494 | DSSTOX compound identifier | DTXCID40384831 |
| P3117 | DSSTox substance ID | DTXSID60434004 |
| P234 | InChI | InChI=1S/C29H40O5/c1-15(17(3)27(33)34)7-8-16(2)19-9-10-20-25-23(31)13-21-18(4)22(30)11-12-28(21,5)26(25)24(32)14-29(19,20)6/h16-21H,1,7-14H2,2-6H3,(H,33,34)/t16-,17?,18+,19-,20+,21+,28+,29-/m1/s1 |
| P235 | InChIKey | DVORYMAGXQGBQK-QCMFUGJUSA-N |
| P2017 | isomeric SMILES | C[C@H]1[C@@H]2CC(=O)C3=C([C@]2(CCC1=O)C)C(=O)C[C@]4([C@H]3CC[C@@H]4[C@H](C)CCC(=C)C(C)C(=O)O)C |
| P662 | PubChem CID | 10004842 |
| P1579 | Reaxys registry number | 9824952 |
| P11089 | UniChem compound ID | 1058065 |
| P703 | found in taxon | Antrodia cinnamomea | Q10413755 |
| Taiwanofungus camphoratus | Q15636116 | ||
| P2067 | mass | 468.287574 |
| Q34459302 | Biologically active constituents from the fruiting body of Taiwanofungus camphoratus |
| Q34361110 | Camphoratins A−J, Potent Cytotoxic and Anti-inflammatory Triterpenoids from the Fruiting Body of Taiwanofungus camphoratus |
| Q44850065 | Evaluation of the anti-inflammatory activity of zhankuic acids isolated from the fruiting bodies of Antrodia camphorata |
| Q47192265 | New steroid acids from Antrodia cinnamomea, a fungal parasite of Cinnamomum micranthum |
Search more.