| P233 | canonical SMILES | CC1C(CCC2(C1CC(=O)C3=C2C(=O)CC4(C3CCC4C(C)CCC(=C)C(C)C(=O)O)C)C)O |
| P683 | ChEBI ID | 66504 |
| P592 | ChEMBL ID | CHEMBL1644790 |
| P661 | ChemSpider ID | 26375603 |
| P234 | InChI | InChI=1S/C29H42O5/c1-15(17(3)27(33)34)7-8-16(2)19-9-10-20-25-23(31)13-21-18(4)22(30)11-12-28(21,5)26(25)24(32)14-29(19,20)6/h16-22,30H,1,7-14H2,2-6H3,(H,33,34)/t16-,17?,18+,19-,20+,21+,22-,28+,29-/m1/s1 |
| P235 | InChIKey | TXEJUZMIQVTZHO-JNXQNPAGSA-N |
| P2017 | isomeric SMILES | C[C@@H]1[C@@H](CC[C@]2([C@H]1CC(=O)C3=C2C(=O)C[C@]4([C@H]3CC[C@@H]4[C@H](C)CCC(=C)C(C)C(=O)O)C)C)O |
| P662 | PubChem CID | 53323940 |
| P1579 | Reaxys registry number | 9825705 |
| P11089 | UniChem compound ID | 1038148 |
| P703 | found in taxon | Antrodia cinnamomea | Q10413755 |
| Taiwanofungus camphoratus | Q15636116 | ||
| P2067 | mass | 470.303224 |
| Q34459302 | Biologically active constituents from the fruiting body of Taiwanofungus camphoratus |
| Q34361110 | Camphoratins A−J, Potent Cytotoxic and Anti-inflammatory Triterpenoids from the Fruiting Body of Taiwanofungus camphoratus |
| Q44850065 | Evaluation of the anti-inflammatory activity of zhankuic acids isolated from the fruiting bodies of Antrodia camphorata |
| Q47192265 | New steroid acids from Antrodia cinnamomea, a fungal parasite of Cinnamomum micranthum |
| Q105266650 | (2R,6R)-6-[(3R,4S,5S,10S,13R,14R,17R)-3-hydroxy-4,10,13-trimethyl-7,11-dioxo-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid | subclass of | P279 |
Search more.