| P233 | canonical SMILES | CC1C(CCC2(C1CC(=O)C3=C2C(=O)C(C4(C3CCC4C(C)CCC(=C)C(C)C(=O)O)C)O)C)O |
| P683 | ChEBI ID | 66505 |
| P592 | ChEMBL ID | CHEMBL1644791 |
| P661 | ChemSpider ID | 26381196 |
| P234 | InChI | InChI=1S/C29H42O6/c1-14(16(3)27(34)35)7-8-15(2)18-9-10-19-23-22(31)13-20-17(4)21(30)11-12-28(20,5)24(23)25(32)26(33)29(18,19)6/h15-21,26,30,33H,1,7-13H2,2-6H3,(H,34,35)/t15-,16?,17+,18-,19+,20+,21-,26+,28+,29-/m1/s1 |
| P235 | InChIKey | LVFHKUZOQUATIE-NIQDNRFFSA-N |
| P2017 | isomeric SMILES | C[C@@H]1[C@@H](CC[C@]2([C@H]1CC(=O)C3=C2C(=O)[C@@H]([C@]4([C@H]3CC[C@@H]4[C@H](C)CCC(=C)C(C)C(=O)O)C)O)C)O |
| P662 | PubChem CID | 53318662 |
| P1579 | Reaxys registry number | 9827877 |
| P11089 | UniChem compound ID | 1015598 |
| P703 | found in taxon | Antrodia cinnamomea | Q10413755 |
| Taiwanofungus camphoratus | Q15636116 | ||
| P2067 | mass | 486.298 |
| Q105157823 | (2R,6R)-6-[(3R,4S,5S,10S,12R,13R,14R,17R)-3,12-dihydroxy-4,10,13-trimethyl-7,11-dioxo-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid |
| Q105157824 | Antcin H |
| Q34459302 | Biologically active constituents from the fruiting body of Taiwanofungus camphoratus |
| Q34361110 | Camphoratins A−J, Potent Cytotoxic and Anti-inflammatory Triterpenoids from the Fruiting Body of Taiwanofungus camphoratus |
| Q44850065 | Evaluation of the anti-inflammatory activity of zhankuic acids isolated from the fruiting bodies of Antrodia camphorata |
| Q47192265 | New steroid acids from Antrodia cinnamomea, a fungal parasite of Cinnamomum micranthum |
| Q79658179 | Zhankuic acid F: a new metabolite from a formosan fungus Antrodia cinnamomea |
Search more.