| type of chemical entity | Q113145171 |
| 2,6-dimethyloctane monoterpenoid | Q108485826 |
| 6C-substituted flavanone | Q108876569 |
| P233 | canonical SMILES | CC(=CCCC(=CCC1=C(C=C2C(=C1O)C(=O)CC(O2)C3=CC(=C(C=C3)O)O)O)C)C |
| P683 | ChEBI ID | 66640 |
| P592 | ChEMBL ID | CHEMBL223256 |
| P661 | ChemSpider ID | 554888 |
| P234 | InChI | InChI=1S/C25H28O6/c1-14(2)5-4-6-15(3)7-9-17-19(27)12-23-24(25(17)30)21(29)13-22(31-23)16-8-10-18(26)20(28)11-16/h5,7-8,10-12,22,26-28,30H,4,6,9,13H2,1-3H3/b15-7+/t22-/m0/s1 |
| P235 | InChIKey | XCYSQFHYFNWYFP-CEMXSPGASA-N |
| P2017 | isomeric SMILES | CC(=CCC/C(=C/CC1=C(C=C2C(=C1O)C(=O)C[C@H](O2)C3=CC(=C(C=C3)O)O)O)/C)C |
| P9405 | NMRShiftDB structure ID | 10019203 |
| P3636 | PDB ligand ID | L2E |
| P11199 | Probes And Drugs ID | PD134524 |
| P662 | PubChem CID | 639465 |
| P1579 | Reaxys registry number | 6013993 |
| P2877 | SureChEMBL ID | SCHEMBL7795014 |
| P11089 | UniChem compound ID | 346621 |
| P703 | found in taxon | Paulownia tomentosa | Q157393 |
| Macaranga tanarius | Q3020630 | ||
| Hernandia nymphaeifolia | Q5456067 | ||
| Propolis | Q7250350 | ||
| Macaranga alnifolia | Q15357562 | ||
| Schizolaena hystrix | Q15571159 | ||
| P2067 | mass | 424.189 | |
| P3364 | stereoisomer of | (2S)-2-(3,4-dihydroxyphenyl)-6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one | Q105325557 |
| Q44743654 | A new prenylated flavonoid from propolis collected in Okinawa, Japan |
| Q46738653 | Antibacterial C-geranylflavonoids from Paulownia tomentosa Fruits. |
| Q37038358 | Antiproliferative prenylated stilbenes and flavonoids from Macaranga alnifolia from the Madagascar rainforest |
| Q41309486 | C-Geranylated Flavanones from Paulownia tomentosa Fruits as Potential Anti-inflammatory Compounds Acting via Inhibition of TNF-α Production |
| Q34649351 | C-geranyl compounds from Paulownia tomentosa fruits |
| Q53382895 | Cholinestrase inhibitory effects of geranylated flavonoids from Paulownia tomentosa fruits. |
| Q81883233 | Constituents of the leaves of Macaranga tanarius |
| Q105344511 | Cytotoxic Flavanones of Schizolaena hystrix from the Madagascar Rainforest |
| Q40443214 | Cytotoxic flavanones of Schizolaena hystrix from the Madagascar rainforest |
| Q46800399 | Geranylated flavanones from the secretion on the surface of the immature fruits of Paulownia tomentosa |
| Q51036588 | Geranylated flavonoids displaying SARS-CoV papain-like protease inhibition from the fruits of Paulownia tomentosa. |
| Q105115087 | New Prenylflavanones from Hernandia nymphaefplia (Presl) Kubitzki |
| Q105325557 | (2S)-2-(3,4-dihydroxyphenyl)-6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one | stereoisomer of | P3364 |
Search more.