Wikidata entity: Q27137018
C₂₈H₃₂N₂O₇ (P274)
Quantities
| P2067 | mass | 508.220951 |
| P3780 | active ingredient in | ... | Q29005934 (Hirobriz Breezhaler) | Hirobriz Breezhaler |
| P3780 | active ingredient in | ... | Q29006270 (Onbrez Breezhaler) | Onbrez Breezhaler |
| P3780 | active ingredient in | ... | Q29006298 (Oslif Breezhaler) | Oslif Breezhaler |
| P233 | canonical SMILES | String | CCC1=C(C=C2CC(CC2=C1)NCC(C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC.C(=CC(=O)O)C(=O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCC1=C(C=C2CC(CC2=C1)NC[C@@H](C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC.C(=C\C(=O)O)\C(=O)O | ??? |
| P2175 | medical condition treated | ... | Q199804 (chronic obstructive pulmonary disease) | chronic obstructive pulmonary disease |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 753498-25-8 |
| P683 | ChEBI ID | 68573 |
| P592 | ChEMBL ID | CHEMBL1789842 |
| P661 | ChemSpider ID | 8003340 |
| P715 | DrugBank ID | DBSALT000101 |
| P232 | EC number | 691-329-4 |
| P2566 | ECHA Substance Infocard ID | 100.218.963 |
| P2057 | Human Metabolome Database ID | HMDB0015608 |
| P234 | InChI | InChI=1S/C24H28N2O3.C4H4O4/c1-3-14-9-16-11-18(12-17(16)10-15(14)4-2)25-13-22(28)19-5-7-21(27)24-20(19)6-8-23(29)26-24;5-3(6)1-2-4(7)8/h5-10,18,22,25,27-28H,3-4,11-13H2,1-2H3,(H,26,29);1-2H,(H,5,6)(H,7,8)/b;2-1-/t22-;/m0./s1 |
| P235 | InChIKey | IREJFXIHXRZFER-PCBAQXHCSA-N |
| P665 | KEGG ID | D09319 |
| P11199 | Probes And Drugs ID | PD012764 |
| P662 | PubChem CID | 9827599 |
| P1579 | Reaxys registry number | 12070553 |
| P3345 | RxNorm CUI | 1114325 |
| P2877 | SureChEMBL ID | 523627 |
| P2877 | SureChEMBL ID | 29629151 |
| P11089 | UniChem compound ID | 1076246 |
| P652 | UNII | 2JEC1ITX7R |
Why not click here or view trends?
log id: 10203822