| group of stereoisomers | Q59199015 |
| 4-methylergostane steroid | Q108677572 |
| P233 | canonical SMILES | CC1C2CCC3=C(C2(CCC1=O)C)C(=O)CC4(C3CCC4C(C)CCC(=C)C(C)C(=O)OC)C |
| P231 | CAS Registry Number | 169477-80-9 |
| P683 | ChEBI ID | 70317 |
| P592 | ChEMBL ID | CHEMBL1258116 |
| P661 | ChemSpider ID | 26364485 |
| P3117 | DSSTox substance ID | DTXSID001315886 |
| P234 | InChI | InChI=1S/C30H44O4/c1-17(19(3)28(33)34-7)8-9-18(2)22-12-13-24-21-10-11-23-20(4)25(31)14-15-29(23,5)27(21)26(32)16-30(22,24)6/h18-20,22-24H,1,8-16H2,2-7H3/t18-,19?,20+,22-,23+,24+,29+,30-/m1/s1 |
| P235 | InChIKey | JVQOVXPSHOWVQH-ZSGULCPNSA-N |
| P2017 | isomeric SMILES | C[C@H]1[C@@H]2CCC3=C([C@]2(CCC1=O)C)C(=O)C[C@]4([C@H]3CC[C@@H]4[C@H](C)CCC(=C)C(C)C(=O)OC)C |
| P662 | PubChem CID | 52947057 |
| P11089 | UniChem compound ID | 786203 |
| P703 | found in taxon | Taiwanofungus camphoratus | Q15636116 |
| P2067 | mass | 468.324 |
| Q34459302 | Biologically active constituents from the fruiting body of Taiwanofungus camphoratus |
| Q34361110 | Camphoratins A−J, Potent Cytotoxic and Anti-inflammatory Triterpenoids from the Fruiting Body of Taiwanofungus camphoratus |
| Q39659464 | Methylantcinate A induces tumor specific growth inhibition in oral cancer cells via Bax-mediated mitochondrial apoptotic pathway |
Search more.