Wikidata entity: Q27145415
C₃H₆N₂O₂ (P274)
Quantities
| P2067 | mass | 102.042927 |
| P233 | canonical SMILES | String | C1C(C(=O)NO1)N | ??? |
| P703 | found in taxon | ... | Q26270527 (Pantoea ananatis) | Pantoea ananatis |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1[C@@H](C(=O)NO1)N | ??? |
| P3364 | stereoisomer of | ... | Q418508 (cycloserine) | cycloserine |
| P279 | subclass of | ... | Q70702 (alkaloid) | alkaloid |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | levcycloserine | ??? |
| P231 | CAS Registry Number | 339-72-0 |
| P683 | ChEBI ID | 75592 |
| P592 | ChEMBL ID | CHEMBL448864 |
| P661 | ChemSpider ID | 395808 |
| P715 | DrugBank ID | DB17627 |
| P3117 | DSSTox substance ID | DTXSID701017231 |
| P232 | EC number | 206-427-0 |
| P2566 | ECHA Substance Infocard ID | 100.005.843 |
| P595 | Guide to Pharmacology Ligand ID | 9488 |
| P234 | InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m0/s1 |
| P235 | InChIKey | DYDCUQKUCUHJBH-REOHCLBHSA-N |
| P665 | KEGG ID | D04706 |
| P2840 | NSC number | 760409 |
| P11199 | Probes And Drugs ID | PD000159 |
| P662 | PubChem CID | 449215 |
| P662 | PubChem CID | 46926143 |
| P1579 | Reaxys registry number | 80799 |
| P2877 | SureChEMBL ID | 243772 |
| P652 | UNII | AK7DRB7FMO |
Why not click here or view trends?
log id: 5429972