Wikidata entity: Q27157250
C₃₉H₅₇FN₄O₄ (P274)
Quantities
| P2067 | mass | 664.436 |
| P3780 | active ingredient in | ... | Q29006597 (Trevicta) | Trevicta |
| P3780 | active ingredient in | ... | Q29006688 (Xeplion) | Xeplion |
| P233 | canonical SMILES | String | CCCCCCCCCCCCCCCC(=O)OC1CCCN2C1=NC(=C(C2=O)CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F)C | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P3493 | legal status (medicine) | ... | Q879952 (boxed warning) | boxed warning |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q208144 (antipsychotics) | antipsychotics |
| P2868 | subject has role | ... | Q50430396 (Serotonin 5-HT2 Receptor Antagonists) | Serotonin 5-HT2 Receptor Antagonists |
| P2868 | subject has role | ... | Q50430491 (Dopamine D2 Receptor Antagonists) | Dopamine D2 Receptor Antagonists |
| P231 | CAS Registry Number | 199739-10-1 |
| P683 | ChEBI ID | 83808 |
| P592 | ChEMBL ID | CHEMBL2107360 |
| P661 | ChemSpider ID | 8028457 |
| P11198 | DrugCentral ID | 4498 |
| P8494 | DSSTOX compound identifier | DTXCID40818000 |
| P3117 | DSSTox substance ID | DTXSID70870217 |
| P232 | EC number | 682-873-3 |
| P2566 | ECHA Substance Infocard ID | 100.208.402 |
| P2057 | Human Metabolome Database ID | HMDB0256085 |
| P234 | InChI | InChI=1S/C39H57FN4O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-36(45)47-34-17-16-24-44-38(34)41-29(2)32(39(44)46)23-27-43-25-21-30(22-26-43)37-33-20-19-31(40)28-35(33)48-42-37/h19-20,28,30,34H,3-18,21-27H2,1-2H3 |
| P235 | InChIKey | VOMKSBFLAZZBOW-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | D000068882 |
| P672 | MeSH tree code | D03.383.129.385.650 |
| P672 | MeSH tree code | D03.383.742.592 |
| P2115 | NDF-RT ID | N0000181687 |
| P10283 | OpenAlex ID | C2908997079 |
| P11199 | Probes And Drugs ID | PD071777 |
| P662 | PubChem CID | 9852746 |
| P3345 | RxNorm CUI | 858045 |
| P2877 | SureChEMBL ID | 1871384 |
| P2892 | UMLS CUI | C0212367 |
| P2892 | UMLS CUI | C2719626 |
| P11089 | UniChem compound ID | 25513866 |
| P652 | UNII | R8P8USM8FR |
Why not click here or view trends?
log id: 5503983