| type of chemical entity | Q113145171 |
| biogenic benzofuran | Q109562462 |
| 3-chromene | Q109583425 |
| P233 | canonical SMILES | CC1(C=CC2=C(O1)C=CC(=C2O)C3=CC4=C(O3)C=C(C=C4)O)C |
| P231 | CAS Registry Number | 164123-54-0 |
| P683 | ChEBI ID | 85109 |
| P592 | ChEMBL ID | CHEMBL233766 |
| P661 | ChemSpider ID | 23294608 |
| P3117 | DSSTox substance ID | DTXSID301178299 |
| P2057 | Human Metabolome Database ID | HMDB0041303 |
| P234 | InChI | InChI=1S/C19H16O4/c1-19(2)8-7-14-15(23-19)6-5-13(18(14)21)17-9-11-3-4-12(20)10-16(11)22-17/h3-10,20-21H,1-2H3 |
| P235 | InChIKey | AOVQEAUIBICOLQ-UHFFFAOYSA-N |
| P2064 | KNApSAcK ID | C00019527 |
| P662 | PubChem CID | 15233562 |
| P1579 | Reaxys registry number | 7141858 |
| P11089 | UniChem compound ID | 98102 |
| P652 | UNII | MM2Q83EZ8W |
| P703 | found in taxon | liquorice | Q257106 |
| Glycyrrhiza uralensis | Q1196166 | ||
| Glycyrrhiza inflata | Q5572787 | ||
| Erythrina addisoniae | Q15491164 | ||
| P2067 | mass | 308.105 |
| Q105116965 | Q105116965 |
| Q46418573 | Biosynthesis-Based Quantitative Analysis of 151 Secondary Metabolites of Licorice To Differentiate Medicinal Glycyrrhiza Species and Their Hybrids. |
| Q38989713 | Glycybridins A-K, Bioactive Phenolic Compounds from Glycyrrhiza glabra. |
| Q60228053 | Inhibitory effect of 2-arylbenzofurans from Erythrina addisoniae on protein tyrosine phosphatase-1B |
| Q104388028 | Isoprenoid-substituted flavonoids from roots of Glycyrrhiza inflata |
| Q36376001 | Screening for bioactive natural products from a 67-compound library of Glycyrrhiza inflata |
| Q104915985 | The Isolation of New Pyrano-2-arylbenzofuran Derivatives from the Root of Glycyrrhiza glabra. |
Search more.