| P233 | canonical SMILES | C1=CC(=C(C(=C1)Cl)N)C2=CNC=C2Cl |
| P231 | CAS Registry Number | 16386-65-5 |
| P683 | ChEBI ID | 85786 |
| P661 | ChemSpider ID | 141586 |
| P8494 | DSSTOX compound identifier | DTXCID7090157 |
| P3117 | DSSTox substance ID | DTXSID40167666 |
| P234 | InChI | InChI=1S/C10H8Cl2N2/c11-8-3-1-2-6(10(8)13)7-4-14-5-9(7)12/h1-5,14H,13H2 |
| P235 | InChIKey | RWAXAHFFXZKMPA-UHFFFAOYSA-N |
| P7746 | Natural Product Atlas ID | NPA012857 |
| P662 | PubChem CID | 161174 |
| P1579 | Reaxys registry number | 475715 |
| P2877 | SureChEMBL ID | SCHEMBL8430894 |
| P11089 | UniChem compound ID | 15344049 |
| P703 | found in taxon | Pseudomonas | Q131143 |
| Burkholderia cepacia | Q139227 | ||
| P2067 | mass | 226.006454 |
| Q104389548 | A new chlorinated phenylpyrrole antibiotic produced by the antifungal bacterium Pseudomonas cepacia |
| Q38474771 | Further biochemical studies on aminopyrrolnitrin oxygenase (PrnD). |
| Q104393971 | High-performance liquid chromatographic analysis of phenylpyrroles produced by Pseudomonas cepacia |
| Q46693381 | Reconstitution and characterization of aminopyrrolnitrin oxygenase, a Rieske N-oxygenase that catalyzes unusual arylamine oxidation |
| Q72570359 | WB2838 [3-chloro-4-(2-amino-3-chlorophenyl)-pyrrole]: non-steroidal androgen-receptor antagonist produced by a Pseudomonas |
Search more.