Abstract is: Methoxyeugenol is a naturall occurring phenylpropene and eugenol derivative. It is found in toxic Japanese star anise pericarp and leaves. as well as in nutmeg crude extract but not in nutmeg essential oil. It also activates PPAR-gamma in vivo.
P7049 | AICS Chemical ID (BEING DELETED) | 10706 |
P233 | canonical SMILES | COC1=CC(=CC(=C1O)OC)CC=C |
P231 | CAS Registry Number | 6627-88-9 |
P683 | ChEBI ID | 86562 |
P592 | ChEMBL ID | CHEMBL2059292 |
P661 | ChemSpider ID | 196968 |
P8494 | DSSTOX compound identifier | DTXCID30138961 |
P3117 | DSSTox substance ID | DTXSID30216470 |
P232 | EC number | 229-600-2 |
P2566 | ECHA Substance Infocard ID | 100.026.910 |
P9066 | FL number | 04.051 |
P2057 | Human Metabolome Database ID | HMDB0041194 |
P234 | InChI | InChI=1S/C11H14O3/c1-4-5-8-6-9(13-2)11(12)10(7-8)14-3/h4,6-7,12H,1,5H2,2-3H3 |
P235 | InChIKey | FWMPKHMKIJDEMJ-UHFFFAOYSA-N |
P9557 | JECFA number | 726 |
P2064 | KNApSAcK ID | C00055253 |
P9405 | NMRShiftDB structure ID | 20040786 |
P2840 | NSC number | 60246 |
16953 | ||
P662 | PubChem CID | 226486 |
P1579 | Reaxys registry number | 1911973 |
P3345 | RxNorm ID | 1423781 |
P2877 | SureChEMBL ID | SCHEMBL293977 |
P11089 | UniChem compound ID | 3564703 |
P652 | UNII | 8VF00YWP89 |
P703 | found in taxon | Illicium anisatum | Q27019 |
Santalum album | Q210858 | ||
Piper auritum | Q585844 | ||
Pimenta racemosa | Q812057 | ||
Piper aduncum | Q3281616 | ||
Illicium | Q5492045 | ||
Spathiphyllum cannifolium | Q9340095 | ||
Illicium dunnianum | Q12237782 | ||
Cocculus orbiculatus | Q15283564 | ||
Myristica argentea | Q17140245 | ||
Asarum asperum var. geaster | Q92989694 | ||
P366 | has use | medication | Q12140 |
P2067 | mass | 194.094294 | |
194.094294308 |