Wikidata entity: Q27163609
C₂₃H₃₂N₂O₅ (P274)
Quantities
| P2067 | mass | 416.231122 |
| P233 | canonical SMILES | String | CCOC(=O)C(CCC1=CC=CC=C1)NC(C)C(=O)N2C3CCCC3CC2C(=O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2[C@H]3CCC[C@H]3CC2C(=O)O | ??? |
| P3364 | stereoisomer of | ... | Q27166335 ((2S,3aR,6aS)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-1-oxopropyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid) | (2S,3aR,6aS)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-1-oxopropyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
| P3364 | stereoisomer of | ... | Q27261839 ((-)-ramipril) | (-)-ramipril |
| P3364 | stereoisomer of | ... | Q27272167 ((R,S,S,S,S)-ramipril epimer) | (R,S,S,S,S)-ramipril epimer |
| P3364 | stereoisomer of | ... | Q27276969 ((2S,3as,6as)-1-((2R)-2-(((1S)-1-(ethoxycarbonyl)-3-phenylpropyl)amino)propanoyl)octahydrocyclopenta(b)pyrrole-2-carboxylic acid) | (2S,3as,6as)-1-((2R)-2-(((1S)-1-(ethoxycarbonyl)-3-phenylpropyl)amino)propanoyl)octahydrocyclopenta(b)pyrrole-2-carboxylic acid |
| P3364 | stereoisomer of | ... | Q27284008 ((2R,3ar,6ar)-1-((2S)-2-(((1S)-1-(ethoxycarbonyl)-3-phenylpropyl)amino)propanoyl)octahydrocyclopenta(b)pyrrole-2-carboxylic acid) | (2R,3ar,6ar)-1-((2S)-2-(((1S)-1-(ethoxycarbonyl)-3-phenylpropyl)amino)propanoyl)octahydrocyclopenta(b)pyrrole-2-carboxylic acid |
| P3364 | stereoisomer of | ... | Q412666 (ramipril) | ramipril |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P683 | ChEBI ID | 91811 |
| P592 | ChEMBL ID | CHEMBL1416376 |
| P661 | ChemSpider ID | 5145998 |
| P234 | InChI | InChI=1S/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20?/m0/s1 |
| P235 | InChIKey | HDACQVRGBOVJII-QJUJLUFUSA-N |
| P11199 | Probes And Drugs ID | PD053401 |
| P662 | PubChem CID | 6714009 |
| P2877 | SureChEMBL ID | 1461098 |
| P11089 | UniChem compound ID | 835031 |
Why not click here or view trends?
log id: 3046532