Wikidata entity: Q27166314
C₃₃H₃₅FN₂O₅ (P274)
Quantities
| P2067 | mass | 558.253 |
| P233 | canonical SMILES | String | CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4 | ??? |
| P31 | instance of | ... | Q59199015 (group of stereoisomers) | group of stereoisomers |
| P279 | subclass of | ... | Q67954132 (pyrrole) | pyrrole |
| P279 | subclass of | ... | Q72192270 (N-substituted primary carboxamide) | N-substituted primary carboxamide |
| P279 | subclass of | ... | Q421916 (diol) | diol |
| P279 | subclass of | ... | Q2200141 (organofluorine) | organofluorine |
| P279 | subclass of | ... | Q4066270 (anilides) | anilides |
| P279 | subclass of | ... | Q10528967 (hydroxy acid) | hydroxy acid |
| P231 | CAS Registry Number | 110862-48-1 |
| P683 | ChEBI ID | 94450 |
| P661 | ChemSpider ID | 2163 |
| P8494 | DSSTOX compound identifier | DTXCID70196489 |
| P3117 | DSSTox substance ID | DTXSID60274003 |
| P234 | InChI | InChI=1S/C33H35FN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40) |
| P235 | InChIKey | XUKUURHRXDUEBC-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD075665 |
| P662 | PubChem CID | 2250 |
| P2877 | SureChEMBL ID | 537781 |
| P11089 | UniChem compound ID | 26017436 |
Why not click here or view trends?
log id: 3262754