Wikidata entity: Q27262951
C₂₁H₃₁N₃O₅ (P274)
Quantities
| P2067 | mass | 405.226 |
| P233 | canonical SMILES | String | C1CC(N(C1)C(=O)C(CCCCN)NC(CCC2=CC=CC=C2)C(=O)O)C(=O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1C[C@H](N(C1)C(=O)[C@H](CCCCN)N[C@H](CCC2=CC=CC=C2)C(=O)O)C(=O)O | ??? |
| P3364 | stereoisomer of | ... | Q412208 (lisinopril) | lisinopril |
| P279 | subclass of | ... | Q81977373 (N2-(1-Carboxy-3-phenylpropyl)-L-lysyl-L-proline) | N2-(1-Carboxy-3-phenylpropyl)-L-lysyl-L-proline |
| P231 | CAS Registry Number | 85955-59-5 |
| P661 | ChemSpider ID | 23936477 |
| P8494 | DSSTOX compound identifier | DTXCID10157776 |
| P3117 | DSSTox substance ID | DTXSID10235285 |
| P234 | InChI | InChI=1S/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17+,18-/m0/s1 |
| P235 | InChIKey | RLAWWYSOJDYHDC-KSZLIROESA-N |
| P11199 | Probes And Drugs ID | PD128766 |
| P662 | PubChem CID | 55187 |
| P11089 | UniChem compound ID | 16626483 |
| P652 | UNII | 5W66M58H0T |
Why not click here or view trends?
log id: 5809314