Wikidata entity: Q27265552
C₆H₇IN₂O (P274)
Quantities
| P2067 | mass | 249.96 |
| P233 | canonical SMILES | String | C1=CC(=CN=C1)C(=O)N.I | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q221441 (pellagra) | pellagra |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 3726-23-6 |
| P661 | ChemSpider ID | 69735 |
| P3117 | DSSTox substance ID | DTXSID401340281 |
| P232 | EC number | 223-081-6 |
| P2566 | ECHA Substance Infocard ID | 100.020.983 |
| P234 | InChI | InChI=1S/C6H6N2O.HI/c7-6(9)5-2-1-3-8-4-5;/h1-4H,(H2,7,9);1H |
| P235 | InChIKey | ITWGXEQHZZFQES-UHFFFAOYSA-N |
| P2115 | NDF-RT ID | N0000147307 |
| P662 | PubChem CID | 77316 |
| P662 | PubChem CID | 517363 |
| P3345 | RxNorm CUI | 317251 |
| P2877 | SureChEMBL ID | 4434788 |
| P2892 | UMLS CUI | C0991853 |
| P652 | UNII | 6UNY448CMZ |
Why not click here or view trends?
log id: 3246246