Wikidata entity: Q27272055
C₆H₁₀O₇ (P274)
Quantities
| P2067 | mass | 194.043 |
| P233 | canonical SMILES | String | C(=O)C(C(C(C(C(=O)O)O)O)O)O | ??? |
| P4149 | conjugate base | ... | Q27104139 (D-mannuronate) | D-mannuronate |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C(=O)[C@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)O | ??? |
| P3364 | stereoisomer of | ... | Q409216 (D-glucouronic acid) | D-glucouronic acid |
| P3364 | stereoisomer of | ... | Q418846 (D-iduronic acid) | D-iduronic acid |
| P3364 | stereoisomer of | ... | Q422729 (D-galacturonic acid) | D-galacturonic acid |
| P3364 | stereoisomer of | ... | Q27103665 (L-guluronic acid) | L-guluronic acid |
| P3364 | stereoisomer of | ... | Q27895463 (L-iduronic acid) | L-iduronic acid |
| P3364 | stereoisomer of | ... | Q82911857 (Hexuronic acid) | Hexuronic acid |
| P3364 | stereoisomer of | ... | Q83115358 (Altruronic acid) | Altruronic acid |
| P3364 | stereoisomer of | ... | Q105036137 ((2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid) | (2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| P279 | subclass of | ... | Q412056 (uronic acid) | uronic acid |
| P6185 | tautomer of | ... | Q27101804 (α-D-mannopyranuronic acid) | α-D-mannopyranuronic acid |
| P6185 | tautomer of | ... | Q27273675 (β-D-mannopyranuronic acid) | β-D-mannopyranuronic acid |
| P231 | CAS Registry Number | 6814-36-4 |
| P661 | ChemSpider ID | 73320 |
| P8494 | DSSTOX compound identifier | DTXCID501012073 |
| P3117 | DSSTox substance ID | DTXSID80873875 |
| P3117 | DSSTox substance ID | DTXSID10218316 |
| P232 | EC number | 229-889-5 |
| P2566 | ECHA Substance Infocard ID | 100.027.172 |
| P2057 | Human Metabolome Database ID | HMDB0302728 |
| P234 | InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3-,4+,5+/m1/s1 |
| P235 | InChIKey | IAJILQKETJEXLJ-MBMOQRBOSA-N |
| P662 | PubChem CID | 81264 |
| P2877 | SureChEMBL ID | 42219 |
| P11089 | UniChem compound ID | 1098210 |
| P652 | UNII | 980IT47Y34 |
Why not click here or view trends?
log id: 9446607