Wikidata entity: Q27275847
C₁₇H₁₇Cl₂N (P274)
Quantities
| P2067 | mass | 305.074 |
| P233 | canonical SMILES | String | CNC1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CN[C@@H]1CC[C@@H](C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl | ??? |
| P3364 | stereoisomer of | ... | Q407617 (sertraline) | sertraline |
| P3364 | stereoisomer of | ... | Q27166476 ((1S,4R)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine) | (1S,4R)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| P3364 | stereoisomer of | ... | Q27260225 (trans-(+/-)-sertraline) | trans-(+/-)-sertraline |
| P279 | subclass of | ... | Q126615335 (4-(3,4-Dichlorophenyl)-n-methyl-1,2,3,4-tetrahydronaphthalen-1-amine) | 4-(3,4-Dichlorophenyl)-n-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| P231 | CAS Registry Number | 79617-98-4 |
| P592 | ChEMBL ID | CHEMBL252744 |
| P661 | ChemSpider ID | 49113 |
| P3117 | DSSTox substance ID | DTXSID401036448 |
| P234 | InChI | InChI=1S/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17-/m1/s1 |
| P235 | InChIKey | VGKDLMBJGBXTGI-SJKOYZFVSA-N |
| P11199 | Probes And Drugs ID | PD160414 |
| P662 | PubChem CID | 54375 |
| P2877 | SureChEMBL ID | 137618 |
| P2877 | SureChEMBL ID | 29690831 |
| P11089 | UniChem compound ID | 963676 |
| P652 | UNII | CVO48CMI7U |
Why not click here or view trends?
log id: 1942768