Wikidata entity: Q27283414
C₁₅H₂₁N₅O₃ (P274)
Quantities
| P2067 | mass | 319.164 |
| P233 | canonical SMILES | String | C1N2CN3CN1CN(C2)C3.C1=CC=C(C=C1)C(=O)NCC(=O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q7900883 (urinary system disease) | urinary system disease |
| P2175 | medical condition treated | ... | Q221668 (urinary tract infection) | urinary tract infection |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q50377189 (urinary anti-infective agents) | urinary anti-infective agents |
| P231 | CAS Registry Number | 5714-73-8 |
| P683 | ChEBI ID | 6825 |
| P592 | ChEMBL ID | CHEMBL1201104 |
| P661 | ChemSpider ID | 20623 |
| P8494 | DSSTOX compound identifier | DTXCID501400072 |
| P3117 | DSSTox substance ID | DTXSID10972603 |
| P232 | EC number | 227-206-5 |
| P2566 | ECHA Substance Infocard ID | 100.024.733 |
| P234 | InChI | InChI=1S/C9H9NO3.C6H12N4/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;1-7-2-9-4-8(1)5-10(3-7)6-9/h1-5H,6H2,(H,10,13)(H,11,12);1-6H2 |
| P235 | InChIKey | ROAIXOJGRFKICW-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C011481 |
| P2115 | NDF-RT ID | N0000146222 |
| P11199 | Probes And Drugs ID | PD051892 |
| P662 | PubChem CID | 21945 |
| P3345 | RxNorm CUI | 29652 |
| P2877 | SureChEMBL ID | 3029 |
| P2892 | UMLS CUI | C0066105 |
| P2892 | UMLS CUI | C0591602 |
| P11089 | UniChem compound ID | 238568 |
| P652 | UNII | M329791L57 |
Why not click here or view trends?
log id: 2712636