Wikidata entity: Q27284615
C₂₂H₂₅Cl₂N₃OS₂ (P274)
Quantities
| P2067 | mass | 481.082 |
| P233 | canonical SMILES | String | C1CN(CCC12NC(=O)CS2)CCCN3C4=CC=CC=C4SC5=C3C=C(C=C5)Cl.Cl | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q170082 (psychosis) | psychosis |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 27007-85-8 |
| P683 | ChEBI ID | 31423 |
| P592 | ChEMBL ID | CHEMBL1967529 |
| P661 | ChemSpider ID | 109485 |
| P8494 | DSSTOX compound identifier | DTXCID203593 |
| P3117 | DSSTox substance ID | DTXSID4023593 |
| P234 | InChI | InChI=1S/C22H24ClN3OS2.ClH/c23-16-6-7-20-18(14-16)26(17-4-1-2-5-19(17)29-20)11-3-10-25-12-8-22(9-13-25)24-21(27)15-28-22;/h1-2,4-7,14H,3,8-13,15H2,(H,24,27);1H |
| P235 | InChIKey | JRSBQVOEILNXGS-UHFFFAOYSA-N |
| P2840 | NSC number | 290956 |
| P662 | PubChem CID | 122820 |
| P662 | PubChem CID | 5458589 |
| P3345 | RxNorm CUI | 1648692 |
| P2877 | SureChEMBL ID | 3501689 |
| P652 | UNII | N6B142V0U0 |
Why not click here or view trends?
log id: 5887848