| P233 |
canonical SMILES |
String |
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)C(=O)O)O)O)O)O)O |
??? |
| P703 |
found in taxon |
... |
Q25419 (Escherichia coli) |
Escherichia coli |
| P703 |
found in taxon |
... |
Q15978631 (Homo sapiens) |
Homo sapiens |
| P31 |
instance of |
... |
Q113145171 (type of chemical entity) |
type of chemical entity |
| P2017 |
isomeric SMILES |
String |
C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)O)O |
??? |
| P361 |
part of |
... |
Q21101957 (UDP-glucuronate biosynthetic process) |
UDP-glucuronate biosynthetic process |
| P361 |
part of |
... |
Q21121300 (UDP-glucuronic acid transmembrane transport) |
UDP-glucuronic acid transmembrane transport |
| P361 |
part of |
... |
Q21154686 (UDP-glucuronate metabolic process) |
UDP-glucuronate metabolic process |
| P129 |
physically interacts with |
... |
Q21121807 (Purinergic receptor P2Y14) |
Purinergic receptor P2Y14 |
| P129 |
physically interacts with |
... |
Q21990430 (Purinergic receptor P2Y, G-protein coupled, 14) |
Purinergic receptor P2Y, G-protein coupled, 14 |
| P279 |
subclass of |
... |
Q27098373 (UDP-alpha-D-galacturonic acid) |
UDP-alpha-D-galacturonic acid |
| P2868 |
subject has role |
... |
Q3333419 (primary metabolite) |
primary metabolite |
| P231 | CAS Registry Number | 2616-64-0 |
| P683 | ChEBI ID | 17200 |
| P592 | ChEMBL ID | CHEMBL228057 |
| P661 | ChemSpider ID | 16522 |
| P715 | DrugBank ID | DB03041 |
| P8494 | DSSTOX compound identifier | DTXCID501331900 |
| P3117 | DSSTox substance ID | DTXSID00903961 |
| P646 | Freebase ID | /m/02kd5l5 |
| P595 | Guide to Pharmacology Ligand ID | 1784 |
| P2057 | Human Metabolome Database ID | HMDB0000935 |
| P234 | InChI | InChI=1S/C15H22N2O18P2/c18-5-1-2-17(15(26)16-5)12-9(22)6(19)4(32-12)3-31-36(27,28)35-37(29,30)34-14-10(23)7(20)8(21)11(33-14)13(24)25/h1-2,4,6-12,14,19-23H,3H2,(H,24,25)(H,27,28)(H,29,30)(H,16,18,26)/t4-,6-,7+,8+,9-,10-,11+,12-,14-/m1/s1 |
| P235 | InChIKey | HDYANYHVCAPMJV-LXQIFKJMSA-N |
| P665 | KEGG ID | C00167 |
| P2064 | KNApSAcK ID | C00007238 |
| P6689 | MassBank accession ID | MSBNK-RIKEN-PR100622 |
| P486 | MeSH descriptor ID | D014535 |
| P672 | MeSH tree code | D03.383.742.686.850.600.677.375 |
| P672 | MeSH tree code | D09.408.620.569.727.375 |
| P672 | MeSH tree code | D13.695.740.850.600.677.375 |
| P672 | MeSH tree code | D13.695.827.708.727.375 |
| P672 | MeSH tree code | D13.695.827.919.600.677.375 |
| P6366 | Microsoft Academic ID (discontinued) | 2780323617 |
| P3636 | PDB ligand ID | UGA |
| P638 | PDB structure ID | 1DLJ |
| P638 | PDB structure ID | 2Z86 |
| P638 | PDB structure ID | 4LK3 |
| P638 | PDB structure ID | 1KWS |
| P638 | PDB structure ID | 2Y0E |
| P638 | PDB structure ID | 2Y0C |
| P638 | PDB structure ID | 2Y0D |
| P638 | PDB structure ID | 3GG2 |
| P638 | PDB structure ID | 3PJG |
| P638 | PDB structure ID | 1Z7E |
| P638 | PDB structure ID | 2QG4 |
| P11199 | Probes And Drugs ID | PD016152 |
| P662 | PubChem CID | 17473 |
| P1579 | Reaxys registry number | 78881 |
| P4964 | SPLASH | splash10-0002-9000000000-fc9ad20b026dc4f896b7 |
| P4964 | SPLASH | splash10-004i-0000090000-766a439d8af0b9401748 |
| P4964 | SPLASH | splash10-004i-0000090000-de055de774be2efd83b5 |
| P4964 | SPLASH | splash10-004i-0000190000-c5b93fb01553ff18d87f |
| P4964 | SPLASH | splash10-0a4i-0002900000-08cd98a102db9b92ed8d |
| P4964 | SPLASH | splash10-0fb9-6935580000-b318343ac4c63183c04d |
| P2877 | SureChEMBL ID | 29351779 |
| P2892 | UMLS CUI | C0041991 |
| P11089 | UniChem compound ID | 375690 |
| P652 | UNII | 04SZC4MEFQ |
